N-[(1-Ethyl-1,2,3,4-tetrahydro-2,2,4-trimethylquinolin)-7-yl]propanamide structure
|
Common Name | N-[(1-Ethyl-1,2,3,4-tetrahydro-2,2,4-trimethylquinolin)-7-yl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 63134-09-8 | Molecular Weight | 274.40100 | |
| Density | 1.005g/cm3 | Boiling Point | 421.3ºC at 760 mmHg | |
| Molecular Formula | C17H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | N-(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-7-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 421.3ºC at 760 mmHg |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.40100 |
| Flash Point | 208.6ºC |
| Exact Mass | 274.20500 |
| PSA | 35.83000 |
| LogP | 4.86170 |
| Index of Refraction | 1.529 |
| InChIKey | AEFPWLPDOOECGX-UHFFFAOYSA-N |
| SMILES | CCC(=O)Nc1ccc2c(c1)N(CC)C(C)(C)CC2C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Propanamide,N-(1-ethyl-1,2,3,4-tetrahydro-2,2,4-trimethyl-7-quinolinyl) |