1-(2,5-Dihydroxy-4-octylphenyl)-1-octanone structure
|
Common Name | 1-(2,5-Dihydroxy-4-octylphenyl)-1-octanone | ||
|---|---|---|---|---|
| CAS Number | 63134-27-0 | Molecular Weight | 348.51900 | |
| Density | 0.999g/cm3 | Boiling Point | 502.2ºC at 760 mmHg | |
| Molecular Formula | C22H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.6ºC | |
| Name | 1-(2,5-dihydroxy-4-octylphenyl)octan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 502.2ºC at 760 mmHg |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.51900 |
| Flash Point | 271.6ºC |
| Exact Mass | 348.26600 |
| PSA | 57.53000 |
| LogP | 6.54400 |
| Index of Refraction | 1.515 |
| InChIKey | DCJOHKAKSCTBKS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1cc(O)c(C(=O)CCCCCCC)cc1O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Octyl-5-octanoyl-hydrochinon |
| 1-Octanone,1-(2,5-dihydroxy-4-octylphenyl) |
| 1-(2,5-dihydroxy-4-octyl-phenyl)-octan-1-one |