Acetic acid, 2-(2,4-dichlorophenoxy)-mixt. with S-ethyl dipropylcarbamothioate structure
|
Common Name | Acetic acid, 2-(2,4-dichlorophenoxy)-mixt. with S-ethyl dipropylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 63146-46-3 | Molecular Weight | 410.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25Cl2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Acetic acid, 2-(2,4-dichlorophenoxy)-mixt. with S-ethyl dipropylcarbamothioate |
|---|
| Molecular Formula | C17H25Cl2NO4S |
|---|---|
| Molecular Weight | 410.4 |
| InChIKey | MXBJOJZUURPVBB-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)SCC.O=C(O)COc1ccc(Cl)cc1Cl |