5-(2,4-dichlorophenyl)-N-naphthalen-1-yl-furan-2-carboxamide structure
|
Common Name | 5-(2,4-dichlorophenyl)-N-naphthalen-1-yl-furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6315-61-3 | Molecular Weight | 220.26800 | |
| Density | 1.127g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Benzyl-3-trimethylsilylpropene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.26800 |
| Exact Mass | 220.12100 |
| PSA | 72.19000 |
| LogP | 2.54140 |
| Index of Refraction | 1.541 |
| InChIKey | OZBQWXRWNSSGJO-UHFFFAOYSA-N |
| SMILES | CCC(Cc1ccccc1)C(=O)NC(N)=O |
|
~%
5-(2,4-dichloro... CAS#:6315-61-3 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2-Benzyl-butyryl)-harnstoff |
| (2-benzylallyl)trimethylsilane |
| (2-benzyl-butyryl)-urea |
| Silane,trimethyl[2-(phenylmethyl)-2-propenyl] |