[2-(ethoxymethyl)phenyl]-bis(4-methoxyphenyl)methanol structure
|
Common Name | [2-(ethoxymethyl)phenyl]-bis(4-methoxyphenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 6315-85-1 | Molecular Weight | 378.46100 | |
| Density | 1.133g/cm3 | Boiling Point | 518.8ºC at 760 mmHg | |
| Molecular Formula | C24H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.6ºC | |
| Name | (2-(ethoxymethyl)phenyl)bis(4-methoxyphenyl)methanol |
|---|
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 518.8ºC at 760 mmHg |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.46100 |
| Flash Point | 267.6ºC |
| Exact Mass | 378.18300 |
| PSA | 47.92000 |
| LogP | 4.52450 |
| Index of Refraction | 1.574 |
| InChIKey | XLEOZYMEMDPPFC-UHFFFAOYSA-N |
| SMILES | CCOCc1ccccc1C(O)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
|
~%
[2-(ethoxymethy... CAS#:6315-85-1 |
| Literature: Blicke; Weinkauff Journal of the American Chemical Society, 1932 , vol. 54, p. 1446,1451 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |