2H-1-Benzopyran-2-one,3,3-bis(ethylthio)-3,4,5,6,7,8-hexahydro-4-(4-morpholinyl)- structure
|
Common Name | 2H-1-Benzopyran-2-one,3,3-bis(ethylthio)-3,4,5,6,7,8-hexahydro-4-(4-morpholinyl)- | ||
|---|---|---|---|---|
| CAS Number | 63154-95-0 | Molecular Weight | 357.53100 | |
| Density | 1.23g/cm3 | Boiling Point | 532.5ºC at 760mmHg | |
| Molecular Formula | C17H27NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9ºC | |
| Name | 3,3-bis(ethylsulfanyl)-4-morpholin-4-yl-5,6,7,8-tetrahydro-4H-chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 532.5ºC at 760mmHg |
| Molecular Formula | C17H27NO3S2 |
| Molecular Weight | 357.53100 |
| Flash Point | 275.9ºC |
| Exact Mass | 357.14300 |
| PSA | 89.37000 |
| LogP | 3.21250 |
| Index of Refraction | 1.588 |
| InChIKey | OZVWUMBQYTVGCB-UHFFFAOYSA-N |
| SMILES | CCSC1(SCC)C(=O)OC2=C(CCCC2)C1N1CCOCC1 |
|
~%
2H-1-Benzopyran... CAS#:63154-95-0 |
| Literature: Bargagna,A. et al. Journal of Heterocyclic Chemistry, 1977 , vol. 14, p. 249 - 251 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-bis-ethylsulfanyl-4-morpholin-4-yl-3,4,5,6,7,8-hexahydro-chromen-2-one |