1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)
Modify Date: 2025-10-24 19:41:09
1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) structure
|
Common Name | 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 63156-77-4 | Molecular Weight | 372.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10Cl2F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H10Cl2F3N3 |
|---|---|
| Molecular Weight | 372.2 |
| InChIKey | PNSIJLCEWIRTNX-UHFFFAOYSA-N |
| SMILES | Nc1c(-c2ccc(Cl)cc2)c(C(F)(F)F)nn1-c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)? |
| A: CAS number of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) is 63156-77-4. |
| Q: What is the molecular weight of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)? |
| A: Molecular weight of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) is 372.2. |
| Q: What is the English name of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)? |
| A: The English name of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) is 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl). |
| Q: What is the InChIKey of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)? |
| A: InChIKey of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) is PNSIJLCEWIRTNX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 63156-77-4? |
| A: Chinese name of 63156-77-4 is 63156-77-4. |
| Q: What is the molecular formula of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)? |
| A: Molecular formula of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) is C16H10Cl2F3N3. |
| Q: What is the SMILES notation of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl)? |
| A: SMILES notation of 1H-Pyrazol-5-amine, 1,4-bis(4-chlorophenyl)-3-(trifluoromethyl) is Nc1c(-c2ccc(Cl)cc2)c(C(F)(F)F)nn1-c1ccc(Cl)cc1. |