(6-bromobenzo[1,3]dioxol-5-yl) propanoate structure
|
Common Name | (6-bromobenzo[1,3]dioxol-5-yl) propanoate | ||
|---|---|---|---|---|
| CAS Number | 6316-58-1 | Molecular Weight | 273.08000 | |
| Density | 1.597g/cm3 | Boiling Point | 338.5ºC at 760 mmHg | |
| Molecular Formula | C10H9BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | (6-bromo-1,3-benzodioxol-5-yl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.597g/cm3 |
|---|---|
| Boiling Point | 338.5ºC at 760 mmHg |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08000 |
| Flash Point | 158.5ºC |
| Exact Mass | 271.96800 |
| PSA | 44.76000 |
| LogP | 2.49320 |
| Index of Refraction | 1.569 |
| InChIKey | YGIOYZSVFRBZQH-UHFFFAOYSA-N |
| SMILES | CCC(=O)Oc1cc2c(cc1Br)OCO2 |
|
~%
(6-bromobenzo[1... CAS#:6316-58-1 |
| Literature: Alexander et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1969 |
|
~%
(6-bromobenzo[1... CAS#:6316-58-1 |
| Literature: Alexander et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1969 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-bromo-6-propionyloxy-benzo[1,3]dioxole |
| 6-bromo-1,3-benzodioxol-5-yl propanoate |
| 5-Brom-6-propionyloxy-benzo[1,3]dioxol |