2,2-bis(4-chlorophenyl)-N-methyl-acetamide structure
|
Common Name | 2,2-bis(4-chlorophenyl)-N-methyl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 6316-74-1 | Molecular Weight | 294.17600 | |
| Density | 1.265g/cm3 | Boiling Point | 486.7ºC at 760 mmHg | |
| Molecular Formula | C15H13Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.1ºC | |
| Name | Benzhydrol,4,4'-dichloro-,bis(p-chlorophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 486.7ºC at 760 mmHg |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.17600 |
| Flash Point | 248.1ºC |
| Exact Mass | 293.03700 |
| PSA | 29.10000 |
| LogP | 4.26220 |
| Index of Refraction | 1.588 |
| InChIKey | AXQWLYVOVYXKFB-UHFFFAOYSA-N |
| SMILES | CNC(=O)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
2,2-bis(4-chlor... CAS#:6316-74-1 |
| Literature: Gokhale; Phalnikar; Bhide Journal of the University of Bombay, Science: Physical Sciences, Mathematics, Biological Sciences and Medicine, 1948 , vol. 16/5 A, p. 32,34 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Di-(4-chlor-phenyl)-essigsaeure-(4,4'-dichlor-benzhydrylester) |
| 2,2-Bis-(4-chloro-phenyl)-N-methyl-acetamide |
| Aceticacid,bis(p-chlorophenyl)-,bis(p-chlorophenyl)methyl ester (8CI) |
| Bis-(4-chlor-phenyl)-essigsaeure-(4,4'-dichlor-benzhydrylester) |
| bis-(4-chloro-phenyl)-acetic acid methylamide |
| Acetic acid,bis(p-chloro-phenyl)-,ester with 4,4'-dichlorobenzhydrol |
| bis-(4-chloro-phenyl)-acetic acid-(4,4'-dichloro-benzhydryl ester) |
| Bis-(4-chlor-phenyl)-essigsaeure-methylamid |
| Benzeneacetic acid,4-chloro-a-(4-chlorophenyl)-,bis(4-chlorophenyl)methyl ester |