2H-1,3,5-Thiadiazine-2-thione,3,5-dihexyltetrahydro- structure
|
Common Name | 2H-1,3,5-Thiadiazine-2-thione,3,5-dihexyltetrahydro- | ||
|---|---|---|---|---|
| CAS Number | 6317-22-2 | Molecular Weight | 302.54200 | |
| Density | 1.22g/cm3 | Boiling Point | 576.1ºC at 760 mmHg | |
| Molecular Formula | C15H30N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.2ºC | |
| Name | 2-Thioxo-3,5-dihexyl-tetrahydro-1,3,5-thiadiazin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 576.1ºC at 760 mmHg |
| Molecular Formula | C15H30N2S2 |
| Molecular Weight | 302.54200 |
| Flash Point | 302.2ºC |
| Exact Mass | 302.18500 |
| PSA | 63.87000 |
| LogP | 4.57350 |
| Index of Refraction | 1.647 |
| InChIKey | GCKQJSDLNOEUFP-UHFFFAOYSA-N |
| SMILES | CCCCCCN1CSC(=S)N(CCCCCC)C1 |
|
~%
2H-1,3,5-Thiadi... CAS#:6317-22-2 |
| Literature: Shah,I.D.; Trivedi,J.P. Journal of the Indian Chemical Society, 1964 , vol. 41, p. 225 - 227 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,5-dihexyl-1,3,5-thiadiazinane-2-thione |