(E)-(4-(Dimethylamino)phenyl)(phenyl)methanone hydrazone structure
|
Common Name | (E)-(4-(Dimethylamino)phenyl)(phenyl)methanone hydrazone | ||
|---|---|---|---|---|
| CAS Number | 6317-69-7 | Molecular Weight | 239.31600 | |
| Density | 1.05g/cm3 | Boiling Point | 388.7ºC at 760 mmHg | |
| Molecular Formula | C15H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | N,N-dimethyl-4-[(Z)-C-phenylcarbonohydrazonoyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 388.7ºC at 760 mmHg |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.31600 |
| Flash Point | 188.9ºC |
| Exact Mass | 239.14200 |
| PSA | 41.62000 |
| LogP | 3.16400 |
| Index of Refraction | 1.574 |
| InChIKey | ILHLDKIEVVAISL-ICFOKQHNSA-N |
| SMILES | CN(C)c1ccc(C(=NN)c2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
(E)-(4-(Dimethy... CAS#:6317-69-7 |
| Literature: Humphreys,R.W.R.; Arnold,D.R. Canadian Journal of Chemistry, 1979 , vol. 57, # 19 p. 2652 - 2661 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Dimethylamino-benzophenonhydrazon |
| 4-dimethylamino-benzophenone-hydrazone |
| p-Dimethylaminobenzophenon-Hydrazon |