methyl 1,1,1,2,4,4,4-heptafluoro-3-oxobutane-2-sulfonate structure
|
Common Name | methyl 1,1,1,2,4,4,4-heptafluoro-3-oxobutane-2-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 63176-10-3 | Molecular Weight | 292.12900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H3F7O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1,1,1,2,4,4,4-heptafluoro-3-oxobutane-2-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H3F7O4S |
|---|---|
| Molecular Weight | 292.12900 |
| Exact Mass | 291.96400 |
| PSA | 68.82000 |
| LogP | 2.40290 |
| InChIKey | CZLMTHRQSMTBLT-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C(F)(C(=O)C(F)(F)F)C(F)(F)F |
|
~%
methyl 1,1,1,2,... CAS#:63176-10-3 |
| Literature: Krespan,C.G. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 1214 - 1217 |
| 2-Butanesulfonic acid,1,1,1,2,4,4,4-heptafluoro-3-oxo-,methyl ester |
| methyl 2-keto-1-trifluoromethyltetrafluoropropanesulfonate |
| 1,1,1,2,4,4,4-heptafluoro-3-oxo-butane-2-sulfonic acid methyl ester |