Cyclohexanol,2-[6-(dimethylamino)-9H-purin-9-yl]-, trans- (9CI) structure
|
Common Name | Cyclohexanol,2-[6-(dimethylamino)-9H-purin-9-yl]-, trans- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6318-03-2 | Molecular Weight | 261.32300 | |
| Density | 1.39g/cm3 | Boiling Point | 474.4ºC at 760 mmHg | |
| Molecular Formula | C13H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.7ºC | |
| Name | (1S,2S)-2-[6-(dimethylamino)purin-9-yl]cyclohexan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 474.4ºC at 760 mmHg |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.32300 |
| Flash Point | 240.7ºC |
| Exact Mass | 261.15900 |
| PSA | 67.07000 |
| LogP | 1.36830 |
| Index of Refraction | 1.697 |
| InChIKey | YXVBWJOBPFQOSB-UWVGGRQHSA-N |
| SMILES | CN(C)c1ncnc2c1ncn2C1CCCCC1O |
|
~%
Cyclohexanol,2-... CAS#:6318-03-2 |
| Literature: Schaeffer; Weimar Journal of the American Chemical Society, 1959 , vol. 81, p. 197,199,200 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| trans-2-(6-dimethylamino-purin-9-yl)-cyclohexanol |
| (1S,2S)-2-(6-dimethylaminopurin-9-yl)cyclohexan-1-ol |