1,3-Benzenediamine,2,4,6-tris(1-methylethyl)- structure
|
Common Name | 1,3-Benzenediamine,2,4,6-tris(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6318-09-8 | Molecular Weight | 234.38000 | |
| Density | 0.959g/cm3 | Boiling Point | 348.7ºC at 760 mmHg | |
| Molecular Formula | C15H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
| Name | 2,4,6-tri(propan-2-yl)benzene-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.959g/cm3 |
|---|---|
| Boiling Point | 348.7ºC at 760 mmHg |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.38000 |
| Flash Point | 196ºC |
| Exact Mass | 234.21000 |
| PSA | 52.04000 |
| LogP | 5.38360 |
| Index of Refraction | 1.545 |
| InChIKey | UCUPHRPMBXOFAU-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(N)c(C(C)C)c1N |
| HS Code | 2921519090 |
|---|
|
~%
1,3-Benzenediam... CAS#:6318-09-8 |
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
|
~%
1,3-Benzenediam... CAS#:6318-09-8 |
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921519090 |
|---|---|
| Summary | 2921519090. o-, m-, p-phenylenediamine, diaminotoluenes, and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4,6-triisopropyl-m-phenylenediamine |
| 2,4,6-Triisopropyl-m-phenylendiamin |
| 2,4,6-triisopropylbenzene-1,3-diamine |