4-(4-chlorophenyl)-3-phenyl-but-3-en-2-one structure
|
Common Name | 4-(4-chlorophenyl)-3-phenyl-but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 6318-76-9 | Molecular Weight | 256.72700 | |
| Density | 1.177g/cm3 | Boiling Point | 401.2ºC at 760 mmHg | |
| Molecular Formula | C16H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | 4-(4-chlorophenyl)-3-phenylbut-3-en-2-one |
|---|
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 401.2ºC at 760 mmHg |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.72700 |
| Flash Point | 226.8ºC |
| Exact Mass | 256.06500 |
| PSA | 17.07000 |
| LogP | 4.46960 |
| Index of Refraction | 1.618 |
| InChIKey | OHUPHNWMLWIYGY-LFIBNONCSA-N |
| SMILES | CC(=O)C(=Cc1ccc(Cl)cc1)c1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|