N,N-dimethyl-2-(2,4,6-tripropan-2-ylphenyl)ethanamine structure
|
Common Name | N,N-dimethyl-2-(2,4,6-tripropan-2-ylphenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 6318-87-2 | Molecular Weight | 275.47200 | |
| Density | 0.88g/cm3 | Boiling Point | 322ºC at 760 mmHg | |
| Molecular Formula | C19H33N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
| Name | N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine |
|---|
| Density | 0.88g/cm3 |
|---|---|
| Boiling Point | 322ºC at 760 mmHg |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.47200 |
| Flash Point | 135.1ºC |
| Exact Mass | 275.26100 |
| PSA | 3.24000 |
| LogP | 5.16090 |
| Index of Refraction | 1.495 |
| InChIKey | CGGHRKNTSWQHMY-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(CCN(C)C)c(C(C)C)c1 |
|
~%
N,N-dimethyl-2-... CAS#:6318-87-2 |
| Literature: Van Eenam; Hauser Journal of the American Chemical Society, 1957 , vol. 79, p. 5520,5523 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |