N,N-dimethyl-2-(2,4,6-tripropan-2-ylphenyl)ethanamine
N,N-dimethyl-2-(2,4,6-tripropan-2-ylphenyl)ethanamine structure
|
Common Name | N,N-dimethyl-2-(2,4,6-tripropan-2-ylphenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 6318-87-2 | Molecular Weight | 275.47200 | |
| Density | 0.88g/cm3 | Boiling Point | 322ºC at 760 mmHg | |
| Molecular Formula | C19H33N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.88g/cm3 |
|---|---|
| Boiling Point | 322ºC at 760 mmHg |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.47200 |
| Flash Point | 135.1ºC |
| Exact Mass | 275.26100 |
| PSA | 3.24000 |
| LogP | 5.16090 |
| Index of Refraction | 1.495 |
| InChIKey | CGGHRKNTSWQHMY-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(CCN(C)C)c(C(C)C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N,N-dimethyl-2-... CAS#:6318-87-2 |
| Literature: Van Eenam; Hauser Journal of the American Chemical Society, 1957 , vol. 79, p. 5520,5523 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: Polar surface area (PSA) of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is 3.24000. |
| Q: What is the English name of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: The English name of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine. |
| Q: What is the LogP of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: LogP of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is 5.16090. |
| Q: What is the SMILES notation of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: SMILES notation of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is CC(C)c1cc(C(C)C)c(CCN(C)C)c(C(C)C)c1. |
| Q: What is the molecular weight of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: Molecular weight of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is 275.47200. |
| Q: What is the boiling point of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: Boiling point of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is 322ºC at 760 mmHg. |
| Q: What are the upstream materials of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: Related upstream materials(CAS) of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine: 4276-84-0. |
| Q: What is the Chinese name of 6318-87-2? |
| A: Chinese name of 6318-87-2 is 6318-87-2. |
| Q: What is the CAS number of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: CAS number of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is 6318-87-2. |
| Q: What is the molecular formula of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine? |
| A: Molecular formula of N,N-dimethyl-2-[2,4,6-tri(propan-2-yl)phenyl]ethanamine is C19H33N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |