ethyl 2-[(carbamoylamino)methylidene]-3-oxo-butanoate structure
|
Common Name | ethyl 2-[(carbamoylamino)methylidene]-3-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 6319-01-3 | Molecular Weight | 200.19200 | |
| Density | 1.219g/cm3 | Boiling Point | 306.2ºC at 760 mmHg | |
| Molecular Formula | C8H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139ºC | |
| Name | ethyl 2-[(carbamoylamino)methylidene]-3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 306.2ºC at 760 mmHg |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19200 |
| Flash Point | 139ºC |
| Exact Mass | 200.08000 |
| PSA | 98.49000 |
| LogP | 0.78190 |
| Index of Refraction | 1.496 |
| InChIKey | FTGFUKQTCIZBEQ-UVJWVVOVSA-N |
| SMILES | CCOC(=O)C(C=NC(N)=O)=C(C)O |
| HS Code | 2924199090 |
|---|
|
~84%
ethyl 2-[(carba... CAS#:6319-01-3 |
| Literature: Majee; Kundu; Santra; Hajra Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2014 , vol. 53, # 1 p. 124 - 126 |
|
~51%
ethyl 2-[(carba... CAS#:6319-01-3 |
| Literature: Palanki; Erdman; Gayo-Fung; Shevlin; Sullivan; Goldman; Ransone; Bennett; Manning; Suto Journal of medicinal chemistry, 2000 , vol. 43, # 21 p. 3995 - 4004 |
|
~%
ethyl 2-[(carba... CAS#:6319-01-3 |
| Literature: Cervinka,O. et al. Zeitschrift fuer Chemie (Stuttgart, Germany), 1971 , vol. 11, # 1 p. 11 - 12 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl ureidoacetate |
| 2-Acetyl-3-ureido-acrylsaeure-aethylester |
| Hydantoinsaeure-aethylester |
| Carbaethoxymethyl-harnstoff |
| ethyl 2-acetyl-3-ureido-2-propenoate |
| ethylaminocarbonylaminoacetate |
| ethyl n-carbamoylglycinate |
| ETHYL HYDANTOATE |
| N-Carbamoyl-glycin-aethylester |
| Carbamidomethylenacetessigsaeureethylester |
| N-ethoxycarbonylmethylureum |
| hydantoic acid ethyl ester |
| ethyl ureidomethyleneacetoacetate |
| 2-acetyl-3-ureido-acrylic acid ethyl ester |
| ethyl ureidomethylene ethanoylacetate |