N,N-dimethyl-1-(2-methyl-3,5-dipropan-2-yl-phenyl)methanamine
Modify Date: 2025-08-25 19:31:55
N,N-dimethyl-1-(2-methyl-3,5-dipropan-2-yl-phenyl)methanamine structure
|
Common Name | N,N-dimethyl-1-(2-methyl-3,5-dipropan-2-yl-phenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 6319-86-4 | Molecular Weight | 233.39200 | |
| Density | 0.889g/cm3 | Boiling Point | 283.8ºC at 760 mmHg | |
| Molecular Formula | C16H27N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6ºC | |
| Name | N,N-dimethyl-1-[2-methyl-3,5-di(propan-2-yl)phenyl]methanamine |
|---|
| Density | 0.889g/cm3 |
|---|---|
| Boiling Point | 283.8ºC at 760 mmHg |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.39200 |
| Flash Point | 114.6ºC |
| Exact Mass | 233.21400 |
| PSA | 3.24000 |
| LogP | 4.30340 |
| Index of Refraction | 1.501 |
| InChIKey | YTMGQXBXBHSSDJ-UHFFFAOYSA-N |
| SMILES | Cc1c(CN(C)C)cc(C(C)C)cc1C(C)C |
|
~%
N,N-dimethyl-1-... CAS#:6319-86-4 |
| Literature: Van Eenam; Hauser Journal of the American Chemical Society, 1957 , vol. 79, p. 5520,5523 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:6319-89-7![trimethyl-[(2-methyl-3,5-dipropan-2-yl-phenyl)methyl]azanium structure](https://image.chemsrc.com/caspic/294/6319-90-0.png)
CAS#:6319-90-0|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1