1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-one structure
|
Common Name | 1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-one | ||
|---|---|---|---|---|
| CAS Number | 63190-87-4 | Molecular Weight | 291.77600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18ClN3O |
|---|---|
| Molecular Weight | 291.77600 |
| Exact Mass | 291.11400 |
| PSA | 47.78000 |
| LogP | 3.33050 |
| InChIKey | SPYIJNRBRKUDJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C(Cc1ccc(Cl)cc1)n1cncn1 |
|
~%
1-(4-chlorophen... CAS#:63190-87-4 |
| Literature: Bayer Aktiengesellschaft Patent: US4578396 A1, 1986 ; |
|
~%
1-(4-chlorophen... CAS#:63190-87-4 |
| Literature: Min, Yong Ki; Asami, Tadao; Fujioka, Shozo; Murofushi, Noboru; Yamaguchi, Isomaro; Yoshida, Shigeo Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 3 p. 425 - 430 |
|
~%
1-(4-chlorophen... CAS#:63190-87-4 |
| Literature: Min, Yong Ki; Asami, Tadao; Fujioka, Shozo; Murofushi, Noboru; Yamaguchi, Isomaro; Yoshida, Shigeo Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 3 p. 425 - 430 |
|
~%
1-(4-chlorophen... CAS#:63190-87-4 |
| Literature: Min, Yong Ki; Asami, Tadao; Fujioka, Shozo; Murofushi, Noboru; Yamaguchi, Isomaro; Yoshida, Shigeo Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 3 p. 425 - 430 |
| 3-Pentanone,1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl) |
| 1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-one |
| 1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)-3-pentanone |
| 5-(4-chlorophenyl)-2,2-dimethyl-4-(1,2,4-triazol-1-yl)-pentan-3-one |
| 1-(4-chloro-phenyl)-4,4-dimethyl-2-[1,2,4]triazol-1-yl-pentan-3-one |