3-Chloropropyl p-toluenesulfonate structure
|
Common Name | 3-Chloropropyl p-toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 632-02-0 | Molecular Weight | 248.726 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 375.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H13ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.0±23.2 °C | |
| Name | 3-chloropropyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.6±25.0 °C at 760 mmHg |
| Molecular Formula | C10H13ClO3S |
| Molecular Weight | 248.726 |
| Flash Point | 181.0±23.2 °C |
| Exact Mass | 248.027390 |
| PSA | 51.75000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | NQCQVNHLNXCSPY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCl)cc1 |
|
~96%
3-Chloropropyl ... CAS#:632-02-0 |
| Literature: Taguri, Tomonori; Yamakawa, Rei; Adachi, Yasushi; Mori, Kenji; Ando, Tetsu Bioscience, Biotechnology and Biochemistry, 2010 , vol. 74, # 1 p. 119 - 124 |
| 1-Propanol, 3-chloro-, 4-methylbenzenesulfonate |
| 3-chloro-1-propyl tosylate |
| 3-chloropropyl tosylate |
| 3-Chloropropyl p-toluenesulfonate |
| 1-Chloro-3-(tolene-p-sulphonyloxy) propane |
| 3-Chloropropyl 4-methylbenzenesulfonate |