1-(3-chloropropyl)-4-(3-methylphenyl)piperazine structure
|
Common Name | 1-(3-chloropropyl)-4-(3-methylphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 6320-26-9 | Molecular Weight | 252.78300 | |
| Density | 1.077g/cm3 | Boiling Point | 384.2ºC at 760 mmHg | |
| Molecular Formula | C14H21ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.2ºC | |
| Name | 1-(3-chloropropyl)-4-(3-methylphenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 384.2ºC at 760 mmHg |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.78300 |
| Flash Point | 186.2ºC |
| Exact Mass | 252.13900 |
| PSA | 6.48000 |
| LogP | 2.74880 |
| Index of Refraction | 1.54 |
| InChIKey | ZAOPVGKFHIPZKJ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N2CCN(CCCCl)CC2)c1 |
|
~86%
1-(3-chloroprop... CAS#:6320-26-9 |
| Literature: Tanabe Seiyaku Co., Ltd. Patent: US4413006 A1, 1983 ; |
|
~77%
1-(3-chloroprop... CAS#:6320-26-9 |
| Literature: Nate; Matsuki; Tsunashima; Ohtsuka; Sekine; Oda; Honma; Ishida; Nakai; Wada Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 6 p. 2394 - 2411 |
|
~%
1-(3-chloroprop... CAS#:6320-26-9 |
| Literature: Pollard et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 764 |
| 1-(3-chloro propyl)-4-(3-methyl phenyl)piperazine |
| 1-(3-Chlor-propyl)-4-m-tolyl-piperazin |
| 1-(3-chloro-propyl)-4-m-tolyl-piperazine |
| 1-(2-chloropropyl)-4-(3-methylphenyl)piperazine |
| 1-(3-chloro-n-propyl)-4-(3-methylphenyl)-piperazine |