Benzenemethanaminium,4-chloro-N,N,N-trimethyl-, chloride (1:1) structure
|
Common Name | Benzenemethanaminium,4-chloro-N,N,N-trimethyl-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6320-45-2 | Molecular Weight | 220.13900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)methyl-trimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15Cl2N |
|---|---|
| Molecular Weight | 220.13900 |
| Exact Mass | 219.05800 |
| InChIKey | JCNRICBAKSSBCP-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)Cc1ccc(Cl)cc1.[Cl-] |
|
~%
Benzenemethanam... CAS#:6320-45-2 |
| Literature: v.Braun; Kuehn; Weismantel Justus Liebigs Annalen der Chemie, 1926 , vol. 449, p. 264 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Trimethyl-<4-chlorbenzyl>-ammoniumhydroxid |