2-(1-methyl-3,4-dihydro-2H-quinolin-1-yl)-1-(4-tert-butylphenyl)ethanone structure
|
Common Name | 2-(1-methyl-3,4-dihydro-2H-quinolin-1-yl)-1-(4-tert-butylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6321-04-6 | Molecular Weight | 322.46400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28NO+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-tert-butylphenyl)-2-(1-methyl-3,4-dihydro-2H-quinolin-1-ium-1-yl)ethanone |
|---|
| Molecular Formula | C22H28NO+ |
|---|---|
| Molecular Weight | 322.46400 |
| Exact Mass | 322.21700 |
| PSA | 17.07000 |
| LogP | 4.85010 |
| InChIKey | LWPKOBFFJUWDOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)C[N+]2(C)CCCc3ccccc32)cc1 |
|
~%
2-(1-methyl-3,4... CAS#:6321-04-6 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4198 |
|
~%
2-(1-methyl-3,4... CAS#:6321-04-6 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 4198 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |