1-(4-hydroxy-2-methyl-5-propan-2-yl-phenyl)-3-phenyl-urea structure
|
Common Name | 1-(4-hydroxy-2-methyl-5-propan-2-yl-phenyl)-3-phenyl-urea | ||
|---|---|---|---|---|
| CAS Number | 6321-10-4 | Molecular Weight | 284.35300 | |
| Density | 1.211g/cm3 | Boiling Point | 354.6ºC at 760 mmHg | |
| Molecular Formula | C17H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.3ºC | |
| Name | 1-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-3-phenylurea |
|---|
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 354.6ºC at 760 mmHg |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.35300 |
| Flash Point | 168.3ºC |
| Exact Mass | 284.15200 |
| PSA | 61.36000 |
| LogP | 4.61400 |
| Index of Refraction | 1.653 |
| InChIKey | CWGSHXDTJQDWKV-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C(C)C)cc1NC(=O)Nc1ccccc1 |
|
~51%
1-(4-hydroxy-2-... CAS#:6321-10-4 |
| Literature: Avdeenko; Konovalova; Sergeeva; Zubatyuk; Palamarchuk; Shishkin Russian Journal of Organic Chemistry, 2008 , vol. 44, # 12 p. 1765 - 1772 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |