1-(4-chlorobutoxy)-2,4-bis(1,1-dimethylpropyl)benzene structure
|
Common Name | 1-(4-chlorobutoxy)-2,4-bis(1,1-dimethylpropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 63217-25-4 | Molecular Weight | 324.92800 | |
| Density | 0.953g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C20H33ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 1-(4-chlorobutoxy)-2,4-bis(2-methylbutan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.953g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Molecular Formula | C20H33ClO |
| Molecular Weight | 324.92800 |
| Flash Point | 194.2ºC |
| Exact Mass | 324.22200 |
| PSA | 9.23000 |
| LogP | 6.45960 |
| Index of Refraction | 1.485 |
| InChIKey | WQXDZIXHDZKOGO-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(OCCCCCl)c(C(C)(C)CC)c1 |
| HS Code | 2909309090 |
|---|
|
~56%
1-(4-chlorobuto... CAS#:63217-25-4 |
| Literature: Yutilov; Svertilova; Minkina; Shcherbina; Kirillova Russian Journal of Applied Chemistry, 2000 , vol. 73, # 7 p. 1220 - 1225 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-bis(2-methylbutan-2-yl)phenyl 4-chlorobutyl ether |
| 1-(4-Chlorobutoxy)-2,4-bis(1,1-dimethylpropyl)benzene |
| EINECS 264-021-9 |