Pyridinium,1-(2-hydroxy-2-phenylethyl)-4-pentyl-, bromide (1:1) structure
|
Common Name | Pyridinium,1-(2-hydroxy-2-phenylethyl)-4-pentyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6322-20-9 | Molecular Weight | 350.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H24BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-pentylpyridin-1-ium-1-yl)-1-phenylethanol,bromide |
|---|
| Molecular Formula | C18H24BrNO |
|---|---|
| Molecular Weight | 350.29300 |
| Exact Mass | 349.10400 |
| PSA | 24.11000 |
| LogP | 0.44440 |
| InChIKey | GLEWPMUEFNBGCI-UHFFFAOYSA-M |
| SMILES | CCCCCc1cc[n+](CC(O)c2ccccc2)cc1.[Br-] |
|
~%
Pyridinium,1-(2... CAS#:6322-20-9 |
| Literature: King; Brownell Journal of the American Chemical Society, 1950 , vol. 72, p. 2507 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |