2-benzhydryloxyethyl-dimethyl-(phenylmethoxycarbonylmethyl)azanium structure
|
Common Name | 2-benzhydryloxyethyl-dimethyl-(phenylmethoxycarbonylmethyl)azanium | ||
|---|---|---|---|---|
| CAS Number | 6322-72-1 | Molecular Weight | 439.97400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H30ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzhydryloxyethyl-dimethyl-(2-oxo-2-phenylmethoxyethyl)azanium,chloride |
|---|
| Molecular Formula | C26H30ClNO3 |
|---|---|
| Molecular Weight | 439.97400 |
| Exact Mass | 439.19100 |
| PSA | 35.53000 |
| LogP | 1.61640 |
| InChIKey | LZBWCGGLIJTOCW-UHFFFAOYSA-M |
| SMILES | C[N+](C)(CCOC(c1ccccc1)c1ccccc1)CC(=O)OCc1ccccc1.[Cl-] |
|
~%
2-benzhydryloxy... CAS#:6322-72-1 |
| Literature: Parke, Davis and Co. Patent: US2464260 , 1946 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|