N-[2-(Diethylamino)ethyl]-3-phenylbutyramide structure
|
Common Name | N-[2-(Diethylamino)ethyl]-3-phenylbutyramide | ||
|---|---|---|---|---|
| CAS Number | 63224-30-6 | Molecular Weight | 262.39000 | |
| Density | 0.978g/cm3 | Boiling Point | 418.4ºC at 760 mmHg | |
| Molecular Formula | C16H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.8ºC | |
| Name | N-[2-(Diethylamino)ethyl]-3-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.978g/cm3 |
|---|---|
| Boiling Point | 418.4ºC at 760 mmHg |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.39000 |
| Flash Point | 206.8ºC |
| Exact Mass | 262.20500 |
| PSA | 35.83000 |
| LogP | 3.47850 |
| Index of Refraction | 1.509 |
| InChIKey | BLPZYUOAGSFQPF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)CC(C)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| GC 80 |
| N-(2-diethylaminoethyl)-3-phenylbutanamide |
| BUTYRAMIDE,N-(2-(DIETHYLAMINO)ETHYL)-3-PHENYL |
| N-(2-(Diethylamino)ethyl)-3-phenylbutyramide |