2,5-Cyclohexadiene-1,4-dione,2,5-bis(diethylamino)- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-bis(diethylamino)- | ||
|---|---|---|---|---|
| CAS Number | 6323-02-0 | Molecular Weight | 250.33700 | |
| Density | 1.06g/cm3 | Boiling Point | 351.9ºC at 760mmHg | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.6ºC | |
| Name | 2,5-bis(diethylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 351.9ºC at 760mmHg |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.33700 |
| Flash Point | 137.6ºC |
| Exact Mass | 250.16800 |
| PSA | 40.62000 |
| LogP | 1.58960 |
| Index of Refraction | 1.528 |
| InChIKey | IHZMGBPXYBCYFI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=O)C(N(CC)CC)=CC1=O |
|
~58%
2,5-Cyclohexadi... CAS#:6323-02-0 |
| Literature: Zhou, Qin; Swager, Timothy M. Journal of Organic Chemistry, 1995 , vol. 60, # 22 p. 7096 - 7100 |
|
~25%
2,5-Cyclohexadi... CAS#:6323-02-0
Detail
|
| Literature: Forrester, Alexander R.; Ogilvy, Munro M.; Thomson, Ronald H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1982 , # 9 p. 2023 - 2026 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-Bis-diaethylamino-p-benzochinon |