1-(4-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone structure
|
Common Name | 1-(4-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6323-40-6 | Molecular Weight | 285.76800 | |
| Density | 1.209g/cm3 | Boiling Point | 440.3ºC at 760 mmHg | |
| Molecular Formula | C17H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 1-(4-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 440.3ºC at 760 mmHg |
| Molecular Formula | C17H16ClNO |
| Molecular Weight | 285.76800 |
| Flash Point | 220.1ºC |
| Exact Mass | 285.09200 |
| PSA | 20.31000 |
| LogP | 3.51890 |
| Index of Refraction | 1.603 |
| InChIKey | GRVFDQMVFOGEEO-UHFFFAOYSA-N |
| SMILES | O=C(CN1CCc2ccccc2C1)c1ccc(Cl)cc1 |
|
~81%
1-(4-chlorophen... CAS#:6323-40-6 |
| Literature: Ganguly, Swastika; Murugesan Journal of the Indian Chemical Society, 2010 , vol. 87, # 7 p. 879 - 885 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |