Pyridinium,1-(9H-fluoren-9-yl)-2-methyl-, bromide (1:1) structure
|
Common Name | Pyridinium,1-(9H-fluoren-9-yl)-2-methyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6323-63-3 | Molecular Weight | 338.24100 | |
| Density | 1.147g/cm3 | Boiling Point | 431.1ºC at 760mmHg | |
| Molecular Formula | C19H16BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | 1-(9H-fluoren-9-yl)-2-methylpyridin-1-ium,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760mmHg |
| Molecular Formula | C19H16BrN |
| Molecular Weight | 338.24100 |
| Flash Point | 190.1ºC |
| Exact Mass | 337.04700 |
| PSA | 3.88000 |
| LogP | 0.90460 |
| Index of Refraction | 1.649 |
| InChIKey | FTNGXHCYUJBFAU-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1C1c2ccccc2-c2ccccc21.[Br-] |
|
~%
Pyridinium,1-(9... CAS#:6323-63-3 |
| Literature: Pinck; Hilbert Journal of the American Chemical Society, 1946 , vol. 68, p. 2014,2016 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(9H-FLUOREN-9-YL)-2-METHYLPYRIDIN-1-IUM BROMIDE |
| 1-fluoren-9-yl-2-methyl-pyridinium,bromide |