1-(2-methyl-1-piperidyl)-3-(2-methyl-6H-pyridin-1-yl)propan-2-ol structure
|
Common Name | 1-(2-methyl-1-piperidyl)-3-(2-methyl-6H-pyridin-1-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 6323-81-5 | Molecular Weight | 324.23600 | |
| Density | 1.011g/cm3 | Boiling Point | 358.9ºC at 760 mmHg | |
| Molecular Formula | C15H20BrN2O+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.8ºC | |
| Name | 1,3-bis(2-methylpyridin-1-ium-1-yl)propan-2-ol,dibromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.011g/cm3 |
|---|---|
| Boiling Point | 358.9ºC at 760 mmHg |
| Molecular Formula | C15H20BrN2O+ |
| Molecular Weight | 324.23600 |
| Flash Point | 155.8ºC |
| Exact Mass | 323.07600 |
| PSA | 27.99000 |
| Index of Refraction | 1.52 |
| InChIKey | OPKSNTWQCXLDRK-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1CC(O)C[n+]1ccccc1C.[Br-] |
|
~%
1-(2-methyl-1-p... CAS#:6323-81-5 |
| Literature: Hartwell; Pogorelskin Journal of the American Chemical Society, 1950 , vol. 72, p. 2040,2041 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-tert-butylcarbonylpyridine |
| 3-pivaloylpyridine |