4-{[3-(Trifluoromethyl)benzyl]oxy}benzoic acid structure
|
Common Name | 4-{[3-(Trifluoromethyl)benzyl]oxy}benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 632366-16-6 | Molecular Weight | 296.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-{[3-(Trifluoromethyl)benzyl]oxy}benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11F3O3 |
|---|---|
| Molecular Weight | 296.24100 |
| Exact Mass | 296.06600 |
| PSA | 46.53000 |
| LogP | 3.98260 |
| InChIKey | IKOXBVAMLHIDQL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
4-{[3-(Trifluor... CAS#:632366-16-6 |
| Literature: NEOGENESIS PHARMACEUTICALS, INC. Patent: WO2003/101993 A1, 2003 ; Location in patent: Page 73-74 ; WO 03/101993 A1 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,2,4-Triazine-3,5(2H,4H)-dione,4-[[3-(trifluoromethyl)phenyl]methyl] |
| 4-(3-trifluoromethyl-benzyl)-2H-[1,2,4]triazine-3,5-dione |
| 4-(3-trifluoromethyl-benzyloxy)-benzoic acid |