pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid
![pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid Structure](https://image.chemsrc.com/caspic/376/63237-87-6.png)
pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid structure
|
Common Name | pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 63237-87-6 | Molecular Weight | 206.15500 | |
| Density | 1.64 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H6N2O4 | Melting Point | 218-218.5ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.64 g/cm3 |
|---|---|
| Melting Point | 218-218.5ºC |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.15500 |
| Exact Mass | 206.03300 |
| PSA | 91.90000 |
| LogP | 0.73070 |
| Index of Refraction | 1.718 |
| InChIKey | ALJPZXOFRCWHID-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nn2ccccc2c1C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
![Dimethyl Pyrazolo[1,5-a]pyridine-2,3-dicarboxylate Structure](https://image.chemsrc.com/caspic/008/5825-71-8.png)
CAS#:5825-71-8![Ethyl esterpyrazolo[1,5-a]pyridine-2-carboxylic acid structure](https://image.chemsrc.com/caspic/446/80537-14-0.png)
CAS#:80537-14-0![Pyrazolo[1.5-a]pyridine-2-carboxylicacid structure](https://image.chemsrc.com/caspic/338/63237-88-7.png)
CAS#:63237-88-7![Pyrazolo[1,5-a]pyridine-2-carboxylic acid hydrazide structure](https://image.chemsrc.com/caspic/408/80537-15-1.png)
CAS#:80537-15-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| OR1412 |
| Pyrazolo<1,5-a>pyridin-2,3-dicarbonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: Melting point of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is 218-218.5ºC. |
| Q: What is the LogP of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: LogP of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is 0.73070. |
| Q: What is the polar surface area (PSA) of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: Polar surface area (PSA) of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is 91.90000. |
| Q: What are the downstream products of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: Related downstream products(CAS) of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid: 80537-14-0;63237-88-7;80537-15-1. |
| Q: What is the CAS number of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: CAS number of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is 63237-87-6. |
| Q: What is the molecular weight of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: Molecular weight of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is 206.15500. |
| Q: What is the molecular formula of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: Molecular formula of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is C9H6N2O4. |
| Q: What is the English name of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: The English name of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid. |
| Q: What is the InChIKey of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: InChIKey of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is ALJPZXOFRCWHID-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid? |
| A: SMILES notation of pyrazolo[1,5-a]pyridine-2,3-dicarboxylic acid is O=C(O)c1nn2ccccc2c1C(=O)O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |