N-(3-methyl-4-sulfamoyl-phenyl)benzamide structure
|
Common Name | N-(3-methyl-4-sulfamoyl-phenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 6324-76-1 | Molecular Weight | 290.33800 | |
| Density | 1.359g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-methyl-4-sulfamoylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.33800 |
| Exact Mass | 290.07300 |
| PSA | 97.64000 |
| LogP | 3.74880 |
| Index of Refraction | 1.639 |
| InChIKey | XHBUDCZTPQKIPT-UHFFFAOYSA-N |
| SMILES | Cc1cc(NC(=O)c2ccccc2)ccc1S(N)(=O)=O |
|
~%
N-(3-methyl-4-s... CAS#:6324-76-1 |
| Literature: Backeberg; Marais Journal of the Chemical Society, 1943 , p. 78 |
|
~%
N-(3-methyl-4-s... CAS#:6324-76-1 |
| Literature: Backeberg; Marais Journal of the Chemical Society, 1943 , p. 78 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoesaeure-(4-sulfamoyl-3-methyl-anilid) |
| 5-benzoylamino-toluene-2-sulfonic acid amide |
| 5-Benzamino-toluolsulfonamid-(2) |
| 5-Benzoylamino-toluol-2-sulfonsaeure-amid |