ethyl N-[4-(3-phenylprop-2-enoyl)phenyl]carbamate structure
|
Common Name | ethyl N-[4-(3-phenylprop-2-enoyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 6324-80-7 | Molecular Weight | 295.33200 | |
| Density | 1.201g/cm3 | Boiling Point | 426.7ºC at 760 mmHg | |
| Molecular Formula | C18H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | Tri-p-toluyl-silanol |
|---|
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 426.7ºC at 760 mmHg |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.33200 |
| Flash Point | 211.9ºC |
| Exact Mass | 295.12100 |
| PSA | 55.40000 |
| LogP | 4.22410 |
| Index of Refraction | 1.632 |
| InChIKey | VOVUAZLJXBOTCE-MDWZMJQESA-N |
| SMILES | CCOC(=O)Nc1ccc(C(=O)C=Cc2ccccc2)cc1 |
|
~%
ethyl N-[4-(3-p... CAS#:6324-80-7 |
| Literature: Lutz et al. Journal of Organic Chemistry, 1949 , vol. 14, p. 982,994 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |