4-Benzoyl-4'-bromobiphenyl structure
|
Common Name | 4-Benzoyl-4'-bromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 63242-14-8 | Molecular Weight | 337.21000 | |
| Density | 1.354 g/cm3 | Boiling Point | 459.6ºC at 760 mmHg | |
| Molecular Formula | C19H13BrO | Melting Point | 157-161 °C(lit.) | |
| MSDS | N/A | Flash Point | 64.1ºC | |
| Name | 4-Benzoyl-4'-bromobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354 g/cm3 |
|---|---|
| Boiling Point | 459.6ºC at 760 mmHg |
| Melting Point | 157-161 °C(lit.) |
| Molecular Formula | C19H13BrO |
| Molecular Weight | 337.21000 |
| Flash Point | 64.1ºC |
| Exact Mass | 336.01500 |
| PSA | 17.07000 |
| LogP | 5.34710 |
| Index of Refraction | 1.627 |
| InChIKey | ITMLYLPKSFZCJK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(-c2ccc(Br)cc2)cc1 |
| WGK Germany | 3 |
|---|---|
| HS Code | 2914700090 |
|
~71%
4-Benzoyl-4'-br... CAS#:63242-14-8 |
| Literature: Conti, R. De; Gimenez, S. M. N.; Haun, M.; Pilli, R. A.; Castro, S. L. De; Duran, N. European Journal of Medicinal Chemistry, 1996 , vol. 31, # 11 p. 915 - 918 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00209630 |
| [4-(4-bromophenyl)phenyl]-phenylmethanone |