2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide
2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide structure
|
Common Name | 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6325-82-2 | Molecular Weight | 365.44500 | |
| Density | 1.34g/cm3 | Boiling Point | 518.5ºC at 760 mmHg | |
| Molecular Formula | C21H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 518.5ºC at 760 mmHg |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.44500 |
| Flash Point | 267.4ºC |
| Exact Mass | 365.10900 |
| PSA | 63.78000 |
| LogP | 5.94870 |
| Index of Refraction | 1.674 |
| InChIKey | WJBVZVXEWPABDI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)c(C)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dimethyl-N-... CAS#:6325-82-2 |
| Literature: Phillips; Frank Journal of Organic Chemistry, 1944 , vol. 9, p. 9,10 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Xanthen-9-yl-m-xylol-4-sulfonamid |
| N-xanthen-9-yl-m-xylene-4-sulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: SMILES notation of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is Cc1ccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)c(C)c1. |
| Q: What is the Chinese name of 6325-82-2? |
| A: Chinese name of 6325-82-2 is 6325-82-2. |
| Q: What are the upstream materials of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: Related upstream materials(CAS) of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide: 90-46-0;7467-12-1. |
| Q: What is the molecular weight of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: Molecular weight of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is 365.44500. |
| Q: What is the CAS number of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: CAS number of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is 6325-82-2. |
| Q: What is the InChIKey of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: InChIKey of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is WJBVZVXEWPABDI-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: LogP of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is 5.94870. |
| Q: What is the polar surface area (PSA) of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: Polar surface area (PSA) of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is 63.78000. |
| Q: What English synonyms does 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide have? |
| A: English synonyms of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide: N-Xanthen-9-yl-m-xylol-4-sulfonamid, N-xanthen-9-yl-m-xylene-4-sulfonamide. |
| Q: What is the English name of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide? |
| A: The English name of 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide is 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |