N-benzyl-N-(2-diethylaminoethyl)-9H-xanthene-9-carboxamide
Modify Date: 2025-08-25 17:34:21
N-benzyl-N-(2-diethylaminoethyl)-9H-xanthene-9-carboxamide structure
|
Common Name | N-benzyl-N-(2-diethylaminoethyl)-9H-xanthene-9-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6325-89-9 | Molecular Weight | 451.00000 | |
| Density | 1.143g/cm3 | Boiling Point | 561.5ºC at 760 mmHg | |
| Molecular Formula | C27H31ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.4ºC | |
| Name | N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 561.5ºC at 760 mmHg |
| Molecular Formula | C27H31ClN2O2 |
| Molecular Weight | 451.00000 |
| Flash Point | 293.4ºC |
| Exact Mass | 450.20700 |
| PSA | 32.78000 |
| LogP | 6.09680 |
| Index of Refraction | 1.601 |
| InChIKey | HANHLBKYWKEGRD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN(Cc1ccccc1)C(=O)C1c2ccccc2Oc2ccccc21.Cl |
|
~%
N-benzyl-N-(2-d... CAS#:6325-89-9 |
| Literature: Searle and Co. Patent: US2661353 , 1951 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1