N-benzyl-N-(2-diethylaminoethyl)-9H-xanthene-9-carboxamide
N-benzyl-N-(2-diethylaminoethyl)-9H-xanthene-9-carboxamide structure
|
Common Name | N-benzyl-N-(2-diethylaminoethyl)-9H-xanthene-9-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6325-89-9 | Molecular Weight | 451.00000 | |
| Density | 1.143g/cm3 | Boiling Point | 561.5ºC at 760 mmHg | |
| Molecular Formula | C27H31ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 561.5ºC at 760 mmHg |
| Molecular Formula | C27H31ClN2O2 |
| Molecular Weight | 451.00000 |
| Flash Point | 293.4ºC |
| Exact Mass | 450.20700 |
| PSA | 32.78000 |
| LogP | 6.09680 |
| Index of Refraction | 1.601 |
| InChIKey | HANHLBKYWKEGRD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN(Cc1ccccc1)C(=O)C1c2ccccc2Oc2ccccc21.Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-benzyl-N-(2-d... CAS#:6325-89-9 |
| Literature: Searle and Co. Patent: US2661353 , 1951 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: SMILES notation of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is CCN(CC)CCN(Cc1ccccc1)C(=O)C1c2ccccc2Oc2ccccc21.Cl. |
| Q: What is the LogP of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: LogP of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is 6.09680. |
| Q: What are the upstream materials of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: Related upstream materials(CAS) of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide: 15855-37-5;26454-53-5. |
| Q: What is the boiling point of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: Boiling point of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is 561.5ºC at 760 mmHg. |
| Q: What is the English name of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: The English name of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide. |
| Q: What is the molecular weight of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: Molecular weight of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is 451.00000. |
| Q: What is the Chinese name of 6325-89-9? |
| A: Chinese name of 6325-89-9 is 6325-89-9. |
| Q: What is the molecular formula of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: Molecular formula of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is C27H31ClN2O2. |
| Q: What is the polar surface area (PSA) of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: Polar surface area (PSA) of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is 32.78000. |
| Q: What is the CAS number of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide? |
| A: CAS number of N-benzyl-N-[2-(diethylamino)ethyl]-9H-xanthene-9-carboxamide is 6325-89-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |