2-(4-aminophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulphonic acid structure
|
Common Name | 2-(4-aminophenyl)-2H-naphtho[1,2-d]triazole-6,8-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 63251-40-1 | Molecular Weight | 420.42000 | |
| Density | 1.84g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H12N4O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-aminophenyl)benzo[e]benzotriazole-6,8-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.84g/cm3 |
|---|---|
| Molecular Formula | C16H12N4O6S2 |
| Molecular Weight | 420.42000 |
| Exact Mass | 420.02000 |
| PSA | 182.23000 |
| LogP | 4.39210 |
| Index of Refraction | 1.819 |
| InChIKey | YEQGESKQWPUAHN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-n2nc3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)cc4c3n2)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
2-(4-aminopheny... CAS#:63251-40-1 |
| Literature: Dobas et al. Collection of Czechoslovak Chemical Communications, 1958 , vol. 23, p. 1346,1349,1350 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-aminophenyl)-2h-naphtho[1,2-d][1,2,3]triazole-6,8-disulfonic acid |
| EINECS 264-047-0 |
| 2-(4-Amino-phenyl)-2H-naphtho[1,2-d][1,2,3]triazol-6,8-disulfonsaeure |
| 2-(4-Aminophenyl)-2H-naphtho(1,2-d)triazole-6,8-disulfonic acid |