1,3,5,7-Tetramethyl-2,4,6,8,9, 10-hexathioadamantane
1,3,5,7-Tetramethyl-2,4,6,8,9, 10-hexathioadamantane structure
|
Common Name | 1,3,5,7-Tetramethyl-2,4,6,8,9, 10-hexathioadamantane | ||
|---|---|---|---|---|
| CAS Number | 6327-74-8 | Molecular Weight | 300.57100 | |
| Density | 1.538g/cm3 | Boiling Point | 339.7ºC at 760 mmHg | |
| Molecular Formula | C8H12S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.538g/cm3 |
|---|---|
| Boiling Point | 339.7ºC at 760 mmHg |
| Molecular Formula | C8H12S6 |
| Molecular Weight | 300.57100 |
| Flash Point | 156.9ºC |
| Exact Mass | 299.92600 |
| PSA | 151.80000 |
| LogP | 5.12120 |
| Index of Refraction | 1.78 |
| InChIKey | APZGKGHAXUURNO-UHFFFAOYSA-N |
| SMILES | CC12SC3(C)SC(C)(S1)SC(C)(S2)S3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:73257-74-6This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5,7-Tetramethyl-2,4,6,8,9,10-hexathiaadamantane |
| 1,3,5,7-tetramethyl-2,4,6,8,10-hexathiaadamantane |
| 1,3,5,7-Tetramethyl-2,4,6,8,9,10-hexathiaadamantan |
| Tetramethylhexathiaadamantane |
| 2,4,6,8,9,10-Hexathiaadamantane,1,3,5,7-tetramethyl |
| tetramethyl-2,4,6,8,9,10-hexathia-adamantane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: InChIKey of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is APZGKGHAXUURNO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: CAS number of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is 6327-74-8. |
| Q: What is the English name of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: The English name of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane. |
| Q: What English synonyms does 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane have? |
| A: English synonyms of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane: 1,3,5,7-Tetramethyl-2,4,6,8,9,10-hexathiaadamantane, 1,3,5,7-tetramethyl-2,4,6,8,10-hexathiaadamantane, 1,3,5,7-Tetramethyl-2,4,6,8,9,10-hexathiaadamantan, Tetramethylhexathiaadamantane, 2,4,6,8,9,10-Hexathiaadamantane,1,3,5,7-tetramethyl, tetramethyl-2,4,6,8,9,10-hexathia-adamantane. |
| Q: What is the polar surface area (PSA) of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: Polar surface area (PSA) of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is 151.80000. |
| Q: What is the Chinese name of 6327-74-8? |
| A: Chinese name of 6327-74-8 is 6327-74-8. |
| Q: What is the LogP of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: LogP of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is 5.12120. |
| Q: What are the downstream products of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: Related downstream products(CAS) of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane: 73257-74-6. |
| Q: What is the SMILES notation of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: SMILES notation of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is CC12SC3(C)SC(C)(S1)SC(C)(S2)S3. |
| Q: What is the molecular weight of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane? |
| A: Molecular weight of 1,3,5,7-tetramethyl-2,4,6,8,9,10- hexathiaadamantane is 300.57100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |