Carbamic acid, 1-naphthalenyl-,3,3-dimethyl-1-(1-methylethyl)butyl ester (9CI) structure
|
Common Name | Carbamic acid, 1-naphthalenyl-,3,3-dimethyl-1-(1-methylethyl)butyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6328-82-1 | Molecular Weight | 313.43400 | |
| Density | 1.059g/cm3 | Boiling Point | 399.8ºC at 760mmHg | |
| Molecular Formula | C20H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6ºC | |
| Name | 2,5,5-trimethylhexan-3-yl N-naphthalen-1-ylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.059g/cm3 |
|---|---|
| Boiling Point | 399.8ºC at 760mmHg |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.43400 |
| Flash Point | 195.6ºC |
| Exact Mass | 313.20400 |
| PSA | 38.33000 |
| LogP | 5.92210 |
| Index of Refraction | 1.569 |
| InChIKey | LUJJRGIFVREVAA-UHFFFAOYSA-N |
| SMILES | CC(C)C(CC(C)(C)C)OC(=O)Nc1cccc2ccccc12 |
|
~%
Carbamic acid, ... CAS#:6328-82-1 |
| Literature: Whitmore; Forster Journal of the American Chemical Society, 1942 , vol. 64, p. 2967 |
|
~%
Carbamic acid, ... CAS#:6328-82-1 |
| Literature: Whitmore; Forster Journal of the American Chemical Society, 1942 , vol. 64, p. 2967 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5,5-trimethylhexan-3-yl naphthalen-1-ylcarbamate |
| 4-(Naphthyl-(1)-carbamoyloxy)-2.2.5-trimethyl-hexan |
| Naphthyl-(1)-carbamidsaeure-(3.3-dimetyl-1-isopropyl-butylester) |
| [1]naphthyl-carbamic acid-(1-isopropyl-3,3-dimethyl-butyl ester) |
| [1]Naphthyl-carbamidsaeure-(1-isopropyl-3,3-dimethyl-butylester) |