1-[2-(ethyl-(2-hydroxyethyl)amino)ethylamino]-6-methoxy-4-methyl-thioxanthen-9-one structure
|
Common Name | 1-[2-(ethyl-(2-hydroxyethyl)amino)ethylamino]-6-methoxy-4-methyl-thioxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 6328-83-2 | Molecular Weight | 422.96900 | |
| Density | 1.25g/cm3 | Boiling Point | 601.6ºC at 760 mmHg | |
| Molecular Formula | C21H27ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.6ºC | |
| Name | 1-[2-[ethyl(2-hydroxyethyl)amino]ethylamino]-6-methoxy-4-methylthioxanthen-9-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 601.6ºC at 760 mmHg |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.96900 |
| Flash Point | 317.6ºC |
| Exact Mass | 422.14300 |
| PSA | 90.04000 |
| LogP | 4.33280 |
| Index of Refraction | 1.641 |
| InChIKey | MJUUMTNADINWNM-UHFFFAOYSA-N |
| SMILES | CCN(CCO)CCNc1ccc(C)c2sc3cc(OC)ccc3c(=O)c12.Cl |
|
~%
1-[2-(ethyl-(2-... CAS#:6328-83-2 |
| Literature: Archer; Suter Journal of the American Chemical Society, 1952 , vol. 74, p. 4296,4301 |
|
~%
1-[2-(ethyl-(2-... CAS#:6328-83-2 |
| Literature: Archer; Suter Journal of the American Chemical Society, 1952 , vol. 74, p. 4296,4301 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1-{2-[Aethyl-(2-hydroxy-aethyl)-amino]-aethylamino}-6-methoxy-4-methyl-thioxanthen-9-on,Hydrochlorid |
| 1-{2-[5-(5-methyl-[2]furyl)-1-p-tolyl-4,5-dihydro-1H-pyrazol-3-yl]-ethyl}-piperidine,hydrochloride |
| 1-{2-[ethyl-(2-hydroxy-ethyl)-amino]-ethylamino}-6-methoxy-4-methyl-thioxanthen-9-one,hydrochloride |
| Pyrazoline,5-(5-methyl-2-furyl)-3-(2-piperidinoethyl)-1-(p-tolyl)-,hydrochloride |
| 5-(5-Methyl-2-furyl)-3-(2-(piperidino)ethyl)-1-(p-tolyl)-1H-pyrazoline hydrochloride |
| 1-{2-[5-(5-Methyl-[2]furyl)-1-p-tolyl-4,5-dihydro-1H-pyrazol-3-yl]-aethyl}-piperidin,Hydrochlorid |