2-pyridin-2-ylethyl N-phenylcarbamate structure
|
Common Name | 2-pyridin-2-ylethyl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 6329-04-0 | Molecular Weight | 242.27300 | |
| Density | 1.215g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 2-pyridin-2-ylethyl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.27300 |
| Flash Point | 167.4ºC |
| Exact Mass | 242.10600 |
| PSA | 51.22000 |
| LogP | 2.94580 |
| Index of Refraction | 1.614 |
| InChIKey | OLDDQNYOPDGXIA-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)OCCc1ccccn1 |
|
~%
2-pyridin-2-yle... CAS#:6329-04-0 |
| Literature: Kitchen; Hanson Journal of the American Chemical Society, 1951 , vol. 73, p. 1838 |
|
~%
2-pyridin-2-yle... CAS#:6329-04-0 |
| Literature: Kitchen; Hanson Journal of the American Chemical Society, 1951 , vol. 73, p. 1838 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| hms3091e22 |