1-Butene,4,4-bis(ethylsulfonyl)
Modify Date: 2026-07-06 12:51:02
1-Butene,4,4-bis(ethylsulfonyl) structure
|
Common Name | 1-Butene,4,4-bis(ethylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 6330-44-5 | Molecular Weight | 240.34000 | |
| Density | 1.213g/cm3 | Boiling Point | 454ºC at 760 mmHg | |
| Molecular Formula | C8H16O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.4ºC | |
| Name | 4,4-bis(ethylsulfonyl)but-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 454ºC at 760 mmHg |
| Molecular Formula | C8H16O4S2 |
| Molecular Weight | 240.34000 |
| Flash Point | 294.4ºC |
| Exact Mass | 240.04900 |
| PSA | 85.04000 |
| LogP | 2.91960 |
| Index of Refraction | 1.481 |
| InChIKey | FHAHTBDDCUNZMT-UHFFFAOYSA-N |
| SMILES | C=CCC(S(=O)(=O)CC)S(=O)(=O)CC |
|
~%
1-Butene,4,4-bi... CAS#:6330-44-5 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 4,4-Bis-aethansulfonyl-but-1-en |
| 4,4-bis-ethanesulfonyl-but-1-ene |