3H-1,3-benzothiazole-2-thione,2,6-dimethylmorpholine structure
|
Common Name | 3H-1,3-benzothiazole-2-thione,2,6-dimethylmorpholine | ||
|---|---|---|---|---|
| CAS Number | 63302-76-1 | Molecular Weight | 282.42500 | |
| Density | N/A | Boiling Point | 305ºC at 760 mmHg | |
| Molecular Formula | C13H18N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.3ºC | |
| Name | 3H-1,3-benzothiazole-2-thione,2,6-dimethylmorpholine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 305ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.42500 |
| Flash Point | 138.3ºC |
| Exact Mass | 282.08600 |
| PSA | 101.19000 |
| LogP | 3.29700 |
| InChIKey | VWSHQXJQGDLFLX-UHFFFAOYSA-N |
| SMILES | CC1CNCC(C)O1.S=c1[nH]c2ccccc2s1 |
| Benzothiazolethiol,compd. with 2,6-dimethylmorpholine (1:1) |
| 2(3H)-Benzothiazolethione,compd. with 2,6-dimethylmorpholine (1:1) |
| 2,6-Dimethylmorpholine benzothiazolethiolate |
| Benzothiazolethiol,compd. with 2,6-dimethylmorpholine |
| Morpholine,2,6-dimethyl-,compd. with 2(3H)-benzothiazolethione (1:1) |
| Morpholine,2,6-dimethyl-,compd. with benzothiazolethiol (1:1) |