3-(2,6-dichlorophenyl)-6-(methylthio)-1,3,5-triazine-2,4(1H,3H)-dione
Modify Date: 2025-09-22 13:30:47
3-(2,6-dichlorophenyl)-6-(methylthio)-1,3,5-triazine-2,4(1H,3H)-dione structure
|
Common Name | 3-(2,6-dichlorophenyl)-6-(methylthio)-1,3,5-triazine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 63308-79-2 | Molecular Weight | 304.15200 | |
| Density | 1.65g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H7Cl2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2,6-dichlorophenyl)-6-methylsulfanyl-1H-1,3,5-triazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Molecular Formula | C10H7Cl2N3O2S |
| Molecular Weight | 304.15200 |
| Exact Mass | 302.96400 |
| PSA | 93.31000 |
| LogP | 2.36180 |
| Index of Refraction | 1.714 |
| InChIKey | BBDTZMZYBJMBRW-UHFFFAOYSA-N |
| SMILES | CSc1nc(=O)n(-c2c(Cl)cccc2Cl)c(=O)[nH]1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 3-(2,6-dichloro-phenyl)-6-methylsulfanyl-1H-[1,3,5]triazine-2,4-dione |
| 1,3,5-Triazine-2,4(1H,3H)-dione,3-(2,6-dichlorophenyl)-6-(methylthio) |
| EINECS 264-091-0 |
| 3-(2,6-Dichlorophenyl)-6-(methylthio)-1,3,5-triazine-2,4(1H,3H)-dione |