Benzene,[3,3-bis(ethylsulfonyl)propyl]- structure
|
Common Name | Benzene,[3,3-bis(ethylsulfonyl)propyl]- | ||
|---|---|---|---|---|
| CAS Number | 6331-39-1 | Molecular Weight | 304.42600 | |
| Density | 1.231g/cm3 | Boiling Point | 550.8ºC at 760mmHg | |
| Molecular Formula | C13H20O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.9ºC | |
| Name | 3,3-bis(ethylsulfonyl)propylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 550.8ºC at 760mmHg |
| Molecular Formula | C13H20O4S2 |
| Molecular Weight | 304.42600 |
| Flash Point | 362.9ºC |
| Exact Mass | 304.08000 |
| PSA | 85.04000 |
| LogP | 3.97630 |
| Index of Refraction | 1.533 |
| InChIKey | JOHFNSNIAPGTKO-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C(CCc1ccccc1)S(=O)(=O)CC |
|
~%
Benzene,[3,3-bi... CAS#:6331-39-1 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [3,3-bis(ethylsulfonyl)propyl]benzene |
| 1,1-bis-ethanesulfonyl-3-phenyl-propane |
| 1,1-Bis-aethansulfonyl-3-phenyl-propan |