1,1-bis(ethylsulfonyl)-2-methyl-octane
1,1-bis(ethylsulfonyl)-2-methyl-octane structure
|
Common Name | 1,1-bis(ethylsulfonyl)-2-methyl-octane | ||
|---|---|---|---|---|
| CAS Number | 6331-41-5 | Molecular Weight | 312.48900 | |
| Density | 1.092g/cm3 | Boiling Point | 490.7ºC at 760 mmHg | |
| Molecular Formula | C13H28O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1-bis(ethylsulfonyl)-2-methyloctane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 490.7ºC at 760 mmHg |
| Molecular Formula | C13H28O4S2 |
| Molecular Weight | 312.48900 |
| Flash Point | 298.2ºC |
| Exact Mass | 312.14300 |
| PSA | 85.04000 |
| LogP | 4.95000 |
| Index of Refraction | 1.47 |
| InChIKey | HZMXJVJBVGTEOY-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)C(S(=O)(=O)CC)S(=O)(=O)CC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1-bis(ethylsu... CAS#:6331-41-5 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-bis-ethanesulfonyl-2-methyl-octane |
| 1,1-Bis-aethansulfonyl-2-methyl-octan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: InChIKey of 1,1-bis(ethylsulfonyl)-2-methyloctane is HZMXJVJBVGTEOY-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: CAS number of 1,1-bis(ethylsulfonyl)-2-methyloctane is 6331-41-5. |
| Q: What English synonyms does 1,1-bis(ethylsulfonyl)-2-methyloctane have? |
| A: English synonyms of 1,1-bis(ethylsulfonyl)-2-methyloctane: 1,1-bis-ethanesulfonyl-2-methyl-octane, 1,1-Bis-aethansulfonyl-2-methyl-octan. |
| Q: What is the molecular weight of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: Molecular weight of 1,1-bis(ethylsulfonyl)-2-methyloctane is 312.48900. |
| Q: What is the boiling point of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: Boiling point of 1,1-bis(ethylsulfonyl)-2-methyloctane is 490.7ºC at 760 mmHg. |
| Q: What is the Chinese name of 6331-41-5? |
| A: Chinese name of 6331-41-5 is 6331-41-5. |
| Q: What is the polar surface area (PSA) of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: Polar surface area (PSA) of 1,1-bis(ethylsulfonyl)-2-methyloctane is 85.04000. |
| Q: What is the English name of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: The English name of 1,1-bis(ethylsulfonyl)-2-methyloctane is 1,1-bis(ethylsulfonyl)-2-methyloctane. |
| Q: What is the molecular formula of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: Molecular formula of 1,1-bis(ethylsulfonyl)-2-methyloctane is C13H28O4S2. |
| Q: What are the upstream materials of 1,1-bis(ethylsulfonyl)-2-methyloctane? |
| A: Related upstream materials(CAS) of 1,1-bis(ethylsulfonyl)-2-methyloctane: 557-35-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |