1,1-bis(ethylsulfonyl)-2-methyl-octane structure
|
Common Name | 1,1-bis(ethylsulfonyl)-2-methyl-octane | ||
|---|---|---|---|---|
| CAS Number | 6331-41-5 | Molecular Weight | 312.48900 | |
| Density | 1.092g/cm3 | Boiling Point | 490.7ºC at 760 mmHg | |
| Molecular Formula | C13H28O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.2ºC | |
| Name | 1,1-bis(ethylsulfonyl)-2-methyloctane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 490.7ºC at 760 mmHg |
| Molecular Formula | C13H28O4S2 |
| Molecular Weight | 312.48900 |
| Flash Point | 298.2ºC |
| Exact Mass | 312.14300 |
| PSA | 85.04000 |
| LogP | 4.95000 |
| Index of Refraction | 1.47 |
| InChIKey | HZMXJVJBVGTEOY-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)C(S(=O)(=O)CC)S(=O)(=O)CC |
|
~%
1,1-bis(ethylsu... CAS#:6331-41-5 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1-bis-ethanesulfonyl-2-methyl-octane |
| 1,1-Bis-aethansulfonyl-2-methyl-octan |