3-(((2-pyridinylmethyl)amino)carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid structure
|
Common Name | 3-(((2-pyridinylmethyl)amino)carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6331-43-7 | Molecular Weight | 274.27200 | |
| Density | 1.4g/cm3 | Boiling Point | 598.6ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.8ºC | |
| Name | 2-(pyridin-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-3-carboxylic acid |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 598.6ºC at 760 mmHg |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.27200 |
| Flash Point | 315.8ºC |
| Exact Mass | 274.09500 |
| PSA | 88.52000 |
| LogP | 0.74290 |
| Index of Refraction | 1.615 |
| InChIKey | OPKJEKZXOQTIPV-UHFFFAOYSA-N |
| SMILES | O=C(O)C1C2C=CC(O2)C1C(=O)NCc1ccccn1 |
|
Name: Assays to identify small molecules inhibitory for eIF4E expression
Source: 13133
Target: N/A
External Id: 20160513eIF4E
|
|
Name: Dicer-mediated maturation of pre-microRNA
Source: Center for Chemical Genomics, University of Michigan
Target: N/A
External Id: TargetID_659_CEMA
|
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|